ChemNet > CAS > 43020-12-8 1-[5-(4-clorofenil)-2-metil-3-furil]etano-1-one
43020-12-8 1-[5-(4-clorofenil)-2-metil-3-furil]etano-1-one
| Nome del prodotto |
1-[5-(4-clorofenil)-2-metil-3-furil]etano-1-one |
| Sinonimi |
1-[5-(4-clorofenil)-2-metilfuran-3-il]etanone |
| Nome inglese |
1-[5-(4-chlorophenyl)-2-methyl-3-furyl]ethan-1-one;1-[5-(4-chlorophenyl)-2-methylfuran-3-yl]ethanone |
| Formula molecolare |
C13H11ClO2 |
| Peso Molecolare |
234.6782 |
| InChI |
InChI=1/C13H11ClO2/c1-8(15)12-7-13(16-9(12)2)10-3-5-11(14)6-4-10/h3-7H,1-2H3 |
| Numero CAS |
43020-12-8 |
| Struttura molecolare |
|
| Densità |
1.189g/cm3 |
| Punto di fusione |
114℃ |
| Punto di ebollizione |
346.1°C at 760 mmHg |
| Indice di rifrazione |
1.55 |
| Punto d'infiammabilità |
163.1°C |
| Pressione di vapore |
5.88E-05mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|